Products 158520-85-5

CAS 158520-85-5 is the registry number for 5-(Isonicotinamido)isophthalic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-(pyridine-4-carbonylamino)benzene-1,3-dicarboxylic acid (CAS 158520-85-5) is a chemical compound with the molecular formula C14H10N2O5 and a molecular weight of 286.24 g/mol. IUPAC name: 5-(pyridine-4-carbonylamino)benzene-1,3-dicarboxylic acid. InChIKey: POMFMMSRVMERFN-UHFFFAOYSA-N.

Identity
Molecular formulaC14H10N2O5
Molecular weight286.24 g/mol
IUPAC name5-(pyridine-4-carbonylamino)benzene-1,3-dicarboxylic acid
InChIKeyPOMFMMSRVMERFN-UHFFFAOYSA-N
SMILESC1=CN=CC=C1C(=O)NC2=CC(=CC(=C2)C(=O)O)C(=O)O

Computed by PubChem (NCBI)