CAS 64896-26-0 appears in our catalog under these names: 5–((4–Carboxyphenyl)diazenyl)–2–hydroxybenzoic acid, 5-((4-Carboxyphenyl)diazenyl)-2-hydroxybenzoic acid 97+%, 5-((4-Carboxyphenyl)diazenyl)-2-hydroxybenzoic acid, 97+%, 97+%, 5-(4-CARBOXY-PHENYLAZO)-2-HYDROXY-BENZOIC ACID, 97+%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
5-[(4-carboxyphenyl)diazenyl]-2-hydroxybenzoic acid (CAS 64896-26-0) is a chemical compound with the molecular formula C14H10N2O5 and a molecular weight of 286.24 g/mol. IUPAC name: 5-[(4-carboxyphenyl)diazenyl]-2-hydroxybenzoic acid. InChIKey: JNVGBRQYZHTBTP-UHFFFAOYSA-N.
| Molecular formula | C14H10N2O5 |
|---|---|
| Molecular weight | 286.24 g/mol |
| IUPAC name | 5-[(4-carboxyphenyl)diazenyl]-2-hydroxybenzoic acid |
| InChIKey | JNVGBRQYZHTBTP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)N=NC2=CC(=C(C=C2)O)C(=O)O |
Computed by PubChem (NCBI)