Products 1245212-48-9
CAS 1245212-48-9 appears in our catalog under these names: 4-(Isonicotinamido)phthalic acid, 95%, 95%, 4-(Isonicotinamido)phthalic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
4-(pyridine-4-carbonylamino)phthalic acid (CAS 1245212-48-9) is a chemical compound with the molecular formula C14H10N2O5 and a molecular weight of 286.24 g/mol. IUPAC name: 4-(pyridine-4-carbonylamino)phthalic acid. InChIKey: LDMMEQRJUXHKES-UHFFFAOYSA-N.
| Molecular formula | C14H10N2O5 |
|---|---|
| Molecular weight | 286.24 g/mol |
| IUPAC name | 4-(pyridine-4-carbonylamino)phthalic acid |
| InChIKey | LDMMEQRJUXHKES-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1NC(=O)C2=CC=NC=C2)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)