Products 1418754-24-1
CAS 1418754-24-1 is the registry number for 5-Bromo-2-chloro-6-fluoro-3H-imidazo[4,5-b]pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-2-chloro-6-fluoro-1H-imidazo[4,5-b]pyridine (CAS 1418754-24-1) is a chemical compound with the molecular formula C6H2BrClFN3 and a molecular weight of 250.45 g/mol. IUPAC name: 5-bromo-2-chloro-6-fluoro-1H-imidazo[4,5-b]pyridine. InChIKey: JGDXUCLIIVKEFR-UHFFFAOYSA-N.
| Molecular formula | C6H2BrClFN3 |
|---|---|
| Molecular weight | 250.45 g/mol |
| IUPAC name | 5-bromo-2-chloro-6-fluoro-1H-imidazo[4,5-b]pyridine |
| InChIKey | JGDXUCLIIVKEFR-UHFFFAOYSA-N |
| SMILES | C1=C2C(=NC(=C1F)Br)N=C(N2)Cl |
Computed by PubChem (NCBI)