Products 933035-36-0

CAS 933035-36-0 is the registry number for 8-Bromo-6-chloro-3-fluoroimidazo[1,2-b]pyridazine, 98%. Offered by: Ambeed. Available pack sizes: 25mg, 50mg, 1g, 250mg, 100mg, 5g.

Structural formula: {0} (CAS {1})

8-bromo-6-chloro-3-fluoroimidazo[1,2-b]pyridazine (CAS 933035-36-0) is a chemical compound with the molecular formula C6H2BrClFN3 and a molecular weight of 250.45 g/mol. IUPAC name: 8-bromo-6-chloro-3-fluoroimidazo[1,2-b]pyridazine. InChIKey: WXWFQLXRQAUZTO-UHFFFAOYSA-N.

Identity
Molecular formulaC6H2BrClFN3
Molecular weight250.45 g/mol
IUPAC name8-bromo-6-chloro-3-fluoroimidazo[1,2-b]pyridazine
InChIKeyWXWFQLXRQAUZTO-UHFFFAOYSA-N
SMILESC1=C(C2=NC=C(N2N=C1Cl)F)Br

Computed by PubChem (NCBI)