CAS 2830342-74-8 appears in our catalog under these names: 7-Bromo-2-chloro-5-fluoropyrrolo(2,1-f)(1,2,4)triazine, 95%, 7-bromo-2-chloro-5-fluoro-pyrrolo[2,1-f][1,2,4]triazine, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 100mg, 250mg, 500mg.
7-bromo-2-chloro-5-fluoropyrrolo[2,1-f][1,2,4]triazine (CAS 2830342-74-8) is a chemical compound with the molecular formula C6H2BrClFN3 and a molecular weight of 250.45 g/mol. IUPAC name: 7-bromo-2-chloro-5-fluoropyrrolo[2,1-f][1,2,4]triazine. InChIKey: CTOXACJOIMMMQH-UHFFFAOYSA-N.
| Molecular formula | C6H2BrClFN3 |
|---|---|
| Molecular weight | 250.45 g/mol |
| IUPAC name | 7-bromo-2-chloro-5-fluoropyrrolo[2,1-f][1,2,4]triazine |
| InChIKey | CTOXACJOIMMMQH-UHFFFAOYSA-N |
| SMILES | C1=C(N2C(=C1F)C=NC(=N2)Cl)Br |
Computed by PubChem (NCBI)