CAS 2386324-97-4 appears in our catalog under these names: 6-Bromo-2-chloro-7-fluoro-[1,2,4]triazolo[1,5-a]pyridine, 97%, 97%, 6-Bromo-2-chloro-7-fluoro-[1,2,4]triazolo[1,5-a]pyridine, 95%. Offered by: Chemat, Chemat Brand. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, on request.
6-bromo-2-chloro-7-fluoro-[1,2,4]triazolo[1,5-a]pyridine (CAS 2386324-97-4) is a chemical compound with the molecular formula C6H2BrClFN3 and a molecular weight of 250.45 g/mol. IUPAC name: 6-bromo-2-chloro-7-fluoro-[1,2,4]triazolo[1,5-a]pyridine. InChIKey: HPYGBKGGVRKQRI-UHFFFAOYSA-N.
| Molecular formula | C6H2BrClFN3 |
|---|---|
| Molecular weight | 250.45 g/mol |
| IUPAC name | 6-bromo-2-chloro-7-fluoro-[1,2,4]triazolo[1,5-a]pyridine |
| InChIKey | HPYGBKGGVRKQRI-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN2C1=NC(=N2)Cl)Br)F |
Computed by PubChem (NCBI)