CAS 141977-92-6 appears in our catalog under these names: (R)-N-(2'-Amino-[1,1'-binaphthalen]-2-yl)acetamide 95%, (R)-N'-Acetyl-1,1'-binaphthyldiamine, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 50mg, 100mg, 250mg.
N-[1-(2-aminonaphthalen-1-yl)naphthalen-2-yl]acetamide (CAS 141977-92-6) is a chemical compound with the molecular formula C22H18N2O and a molecular weight of 326.4 g/mol. IUPAC name: N-[1-(2-aminonaphthalen-1-yl)naphthalen-2-yl]acetamide. InChIKey: BKDWJPPCPHBKAW-UHFFFAOYSA-N.
| Molecular formula | C22H18N2O |
|---|---|
| Molecular weight | 326.4 g/mol |
| IUPAC name | N-[1-(2-aminonaphthalen-1-yl)naphthalen-2-yl]acetamide |
| InChIKey | BKDWJPPCPHBKAW-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C2=CC=CC=C2C=C1)C3=C(C=CC4=CC=CC=C43)N |
Computed by PubChem (NCBI)