CAS 1774338-60-1 is the registry number for 2-(Pyridin-2-yl)-4,5-di-p-tolyloxazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4,5-bis(4-methylphenyl)-2-pyridin-2-yl-1,3-oxazole (CAS 1774338-60-1) is a chemical compound with the molecular formula C22H18N2O and a molecular weight of 326.4 g/mol. IUPAC name: 4,5-bis(4-methylphenyl)-2-pyridin-2-yl-1,3-oxazole. InChIKey: RDSMLTKLKMXTTH-UHFFFAOYSA-N.
| Molecular formula | C22H18N2O |
|---|---|
| Molecular weight | 326.4 g/mol |
| IUPAC name | 4,5-bis(4-methylphenyl)-2-pyridin-2-yl-1,3-oxazole |
| InChIKey | RDSMLTKLKMXTTH-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=C(OC(=N2)C3=CC=CC=N3)C4=CC=C(C=C4)C |
Computed by PubChem (NCBI)