Products 1728-95-6
CAS 1728-95-6 appears in our catalog under these names: 2-(4-Methoxyphenyl)-4,5-diphenyl-1H-imidazole, >98.0%(HPLC)(T), 2-(4-Methoxyphenyl)-4,5-diphenyl-1H-imidazole, 98.0%, 98.0%. Offered by: TCI, Chemat. Available pack sizes: 200mg, 1g, 5g, 25g.
2-(4-methoxyphenyl)-4,5-diphenyl-1H-imidazole (CAS 1728-95-6) is a chemical compound with the molecular formula C22H18N2O and a molecular weight of 326.4 g/mol. IUPAC name: 2-(4-methoxyphenyl)-4,5-diphenyl-1H-imidazole. InChIKey: SNFCQJAJPFWBDJ-UHFFFAOYSA-N.
| Molecular formula | C22H18N2O |
|---|---|
| Molecular weight | 326.4 g/mol |
| IUPAC name | 2-(4-methoxyphenyl)-4,5-diphenyl-1H-imidazole |
| InChIKey | SNFCQJAJPFWBDJ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=NC(=C(N2)C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)