Products 5335-95-5
CAS 5335-95-5 is the registry number for NSC 1008. Offered by: MedChemExpress. Available pack sizes: Get quote.
7-[anilino(phenyl)methyl]quinolin-8-ol (CAS 5335-95-5) is a chemical compound with the molecular formula C22H18N2O and a molecular weight of 326.4 g/mol. IUPAC name: 7-[anilino(phenyl)methyl]quinolin-8-ol. InChIKey: OTNAVATYWOEDMK-UHFFFAOYSA-N.
| Molecular formula | C22H18N2O |
|---|---|
| Molecular weight | 326.4 g/mol |
| IUPAC name | 7-[anilino(phenyl)methyl]quinolin-8-ol |
| InChIKey | OTNAVATYWOEDMK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=C(C3=C(C=CC=N3)C=C2)O)NC4=CC=CC=C4 |
Computed by PubChem (NCBI)