CAS 14198-24-4 is the registry number for 2,5-Dimethoxy-4'-nitrostilbene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 10g, 5g.
1,4-dimethoxy-2-[(E)-2-(4-nitrophenyl)ethenyl]benzene (CAS 14198-24-4) is a chemical compound with the molecular formula C16H15NO4 and a molecular weight of 285.29 g/mol. IUPAC name: 1,4-dimethoxy-2-[(E)-2-(4-nitrophenyl)ethenyl]benzene. InChIKey: HVSBSYHEGIPGAW-ZZXKWVIFSA-N.
| Molecular formula | C16H15NO4 |
|---|---|
| Molecular weight | 285.29 g/mol |
| IUPAC name | 1,4-dimethoxy-2-[(E)-2-(4-nitrophenyl)ethenyl]benzene |
| InChIKey | HVSBSYHEGIPGAW-ZZXKWVIFSA-N |
| SMILES | COC1=CC(=C(C=C1)OC)/C=C/C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)