CAS 424815-42-9 appears in our catalog under these names: 4-(5-Methyl-1,3-dioxo-1,3,3a,4,7,7a-hexahydro-2h-isoindol-2-yl)benzoic acid, 95%, 4-(5-Methyl-1,3-dioxo-3a,4,7,7a-tetrahydro-1H-isoindol-2(3H)-yl)benzoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
4-(5-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)benzoic acid (CAS 424815-42-9) is a chemical compound with the molecular formula C16H15NO4 and a molecular weight of 285.29 g/mol. IUPAC name: 4-(5-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)benzoic acid. InChIKey: CMEDBZOQPCCFKM-UHFFFAOYSA-N.
| Molecular formula | C16H15NO4 |
|---|---|
| Molecular weight | 285.29 g/mol |
| IUPAC name | 4-(5-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)benzoic acid |
| InChIKey | CMEDBZOQPCCFKM-UHFFFAOYSA-N |
| SMILES | CC1=CCC2C(C1)C(=O)N(C2=O)C3=CC=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)