CAS 171806-97-6 appears in our catalog under these names: {[4-(benzyloxy)phenyl]formamido}acetic acid, 96%, {(4-(benzyloxy)phenyl)formamido}acetic acid, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 25g, 5g.
2-[(4-phenylmethoxybenzoyl)amino]acetic acid (CAS 171806-97-6) is a chemical compound with the molecular formula C16H15NO4 and a molecular weight of 285.29 g/mol. IUPAC name: 2-[(4-phenylmethoxybenzoyl)amino]acetic acid. InChIKey: FXMAMTNSEWYEQC-UHFFFAOYSA-N.
| Molecular formula | C16H15NO4 |
|---|---|
| Molecular weight | 285.29 g/mol |
| IUPAC name | 2-[(4-phenylmethoxybenzoyl)amino]acetic acid |
| InChIKey | FXMAMTNSEWYEQC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)C(=O)NCC(=O)O |
Computed by PubChem (NCBI)