CAS 28172-53-4 appears in our catalog under these names: 2-((4-Methoxyphenyl)formamido)-2-phenylacetic acid, 2-[(4-Methoxyphenyl)formamido]-2-phenylacetic acid, 95%, 2-((4-Methoxyphenyl)formamido)-2-phenylacetic acid, 95%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 0,5g, 5g, 1g, 10g, 250mg, 100mg.
2-[(4-methoxybenzoyl)amino]-2-phenylacetic acid (CAS 28172-53-4) is a chemical compound with the molecular formula C16H15NO4 and a molecular weight of 285.29 g/mol. IUPAC name: 2-[(4-methoxybenzoyl)amino]-2-phenylacetic acid. InChIKey: MBNRIDZSQPHJRF-UHFFFAOYSA-N.
| Molecular formula | C16H15NO4 |
|---|---|
| Molecular weight | 285.29 g/mol |
| IUPAC name | 2-[(4-methoxybenzoyl)amino]-2-phenylacetic acid |
| InChIKey | MBNRIDZSQPHJRF-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(=O)NC(C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)