CAS 1420792-86-4 appears in our catalog under these names: 7,7-Dimethyl-2-oxo-1,2,5,6,7,8-hexahydroquinoline-3-carboxylic acid, 97%, 7,7-Dimethyl-2-oxo-1,2,5,6,7,8-hexahydro-quinoline-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
7,7-dimethyl-2-oxo-1,5,6,8-tetrahydroquinoline-3-carboxylic acid (CAS 1420792-86-4) is a chemical compound with the molecular formula C12H15NO3 and a molecular weight of 221.25 g/mol. IUPAC name: 7,7-dimethyl-2-oxo-1,5,6,8-tetrahydroquinoline-3-carboxylic acid. InChIKey: RNOJKOGSFCPGGN-UHFFFAOYSA-N.
| Molecular formula | C12H15NO3 |
|---|---|
| Molecular weight | 221.25 g/mol |
| IUPAC name | 7,7-dimethyl-2-oxo-1,5,6,8-tetrahydroquinoline-3-carboxylic acid |
| InChIKey | RNOJKOGSFCPGGN-UHFFFAOYSA-N |
| SMILES | CC1(CCC2=C(C1)NC(=O)C(=C2)C(=O)O)C |
Computed by PubChem (NCBI)