Products 1420815-74-2
CAS 1420815-74-2 is the registry number for L-Glutamic acid-13C5,15N,d5, 99.9%. Offered by: MedChemExpress. Available pack sizes: 1 mg.
(2S)-2-(15N)azanyl-2,3,3,4,4-pentadeuterio(1,2,3,4,5-13C5)pentanedioic acid (CAS 1420815-74-2) is a chemical compound with the molecular formula C5H9NO4 and a molecular weight of 158.117 g/mol. IUPAC name: (2S)-2-(15N)azanyl-2,3,3,4,4-pentadeuterio(1,2,3,4,5-13C5)pentanedioic acid. InChIKey: WHUUTDBJXJRKMK-MXSWSVQNSA-N.
| Molecular formula | C5H9NO4 |
|---|---|
| Molecular weight | 158.117 g/mol |
| IUPAC name | (2S)-2-(15N)azanyl-2,3,3,4,4-pentadeuterio(1,2,3,4,5-13C5)pentanedioic acid |
| InChIKey | WHUUTDBJXJRKMK-MXSWSVQNSA-N |
| SMILES | [2H][13C@@]([13C](=O)O)([13C]([2H])([2H])[13C]([2H])([2H])[13C](=O)O)[15NH2] |
Computed by PubChem (NCBI)