Products 1420867-93-1
CAS 1420867-93-1 appears in our catalog under these names: 1-(5-Bromopyridin-2-yl)azetidine-3-carboxylic acid, 98%, 3-Azetidinecarboxylic acid, 1-(5-bromo-2-pyridinyl)-, 98%. Offered by: Ambeed, BLDpharm, Fluorochem, Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg.
1-(5-bromo-2-pyridinyl)azetidine-3-carboxylic acid (CAS 1420867-93-1) is a chemical compound with the molecular formula C9H9BrN2O2 and a molecular weight of 257.08 g/mol. IUPAC name: 1-(5-bromo-2-pyridinyl)azetidine-3-carboxylic acid. InChIKey: CFTGVWBPOFXJLT-UHFFFAOYSA-N.
| Molecular formula | C9H9BrN2O2 |
|---|---|
| Molecular weight | 257.08 g/mol |
| IUPAC name | 1-(5-bromo-2-pyridinyl)azetidine-3-carboxylic acid |
| InChIKey | CFTGVWBPOFXJLT-UHFFFAOYSA-N |
| SMILES | C1C(CN1C2=NC=C(C=C2)Br)C(=O)O |
Computed by PubChem (NCBI)