CAS 1420880-37-0 is the registry number for 5-(4'-Methyl-2-biphenyl)tetrazole-d4. Offered by: TRC. Available pack sizes: 250mg, 25mg.
5-[2-(2,3,5,6-tetradeuterio-4-methylphenyl)phenyl]-2H-tetrazole (CAS 1420880-37-0) is a chemical compound with the molecular formula C14H12N4 and a molecular weight of 240.30 g/mol. IUPAC name: 5-[2-(2,3,5,6-tetradeuterio-4-methylphenyl)phenyl]-2H-tetrazole. InChIKey: VWOJMXKARYCRCC-YKVCKAMESA-N.
| Molecular formula | C14H12N4 |
|---|---|
| Molecular weight | 240.30 g/mol |
| IUPAC name | 5-[2-(2,3,5,6-tetradeuterio-4-methylphenyl)phenyl]-2H-tetrazole |
| InChIKey | VWOJMXKARYCRCC-YKVCKAMESA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C)[2H])[2H])C2=CC=CC=C2C3=NNN=N3)[2H] |
Computed by PubChem (NCBI)