Products 6043-00-1
CAS 6043-00-1 is the registry number for 1-Phenyl-3-(pyridin-4-yl)-1H-pyrazol-5-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-phenyl-3-pyridin-4-ylpyrazol-5-amine (CAS 6043-00-1) is a chemical compound with the molecular formula C14H12N4 and a molecular weight of 236.27 g/mol. IUPAC name: 1-phenyl-3-pyridin-4-ylpyrazol-5-amine. InChIKey: DETGUIXJAUBIEM-UHFFFAOYSA-N.
| Molecular formula | C14H12N4 |
|---|---|
| Molecular weight | 236.27 g/mol |
| IUPAC name | 1-phenyl-3-pyridin-4-ylpyrazol-5-amine |
| InChIKey | DETGUIXJAUBIEM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=CC(=N2)C3=CC=NC=C3)N |
Computed by PubChem (NCBI)