CAS 3049-45-4 appears in our catalog under these names: 3,5–Diphenyl–4H–1,2,4–triazol–4–amine, 3,5-Diphenyl-4h-1,2,4-triazol-4-amine, 95%, 3,5-Diphenyl-4H-1,2,4-triazol-4-amine 95%, 3,5-Diphenyl-4H-1,2,4-triazol-4-amine, 95%, 95%. Offered by: GLPBio, Combi-blocks, Ambeed, Chemat. Available pack sizes: 1g, 5g, 250mg.
3,5-diphenyl-1,2,4-triazol-4-amine (CAS 3049-45-4) is a chemical compound with the molecular formula C14H12N4 and a molecular weight of 236.27 g/mol. IUPAC name: 3,5-diphenyl-1,2,4-triazol-4-amine. InChIKey: DAZAXBYJPXKJJL-UHFFFAOYSA-N.
| Molecular formula | C14H12N4 |
|---|---|
| Molecular weight | 236.27 g/mol |
| IUPAC name | 3,5-diphenyl-1,2,4-triazol-4-amine |
| InChIKey | DAZAXBYJPXKJJL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN=C(N2N)C3=CC=CC=C3 |
Computed by PubChem (NCBI)