CAS 25518-15-4 is the registry number for 2-(5-Phenyl-1H-1,2,4-triazol-3-yl)aniline. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
2-(3-phenyl-1H-1,2,4-triazol-5-yl)aniline (CAS 25518-15-4) is a chemical compound with the molecular formula C14H12N4 and a molecular weight of 236.27 g/mol. IUPAC name: 2-(3-phenyl-1H-1,2,4-triazol-5-yl)aniline. InChIKey: MPAXYIQTWKSSLZ-UHFFFAOYSA-N.
| Molecular formula | C14H12N4 |
|---|---|
| Molecular weight | 236.27 g/mol |
| IUPAC name | 2-(3-phenyl-1H-1,2,4-triazol-5-yl)aniline |
| InChIKey | MPAXYIQTWKSSLZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NNC(=N2)C3=CC=CC=C3N |
Computed by PubChem (NCBI)