CAS 1421489-14-6 is the registry number for (S)-4-Methyl-4-phenyl-2-(quinolin-8-yl)-4,5-dihydrooxazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4S)-4-methyl-4-phenyl-2-quinolin-8-yl-5H-1,3-oxazole (CAS 1421489-14-6) is a chemical compound with the molecular formula C19H16N2O and a molecular weight of 288.3 g/mol. IUPAC name: (4S)-4-methyl-4-phenyl-2-quinolin-8-yl-5H-1,3-oxazole. InChIKey: MHEWVMLNQVODDB-LJQANCHMSA-N.
| Molecular formula | C19H16N2O |
|---|---|
| Molecular weight | 288.3 g/mol |
| IUPAC name | (4S)-4-methyl-4-phenyl-2-quinolin-8-yl-5H-1,3-oxazole |
| InChIKey | MHEWVMLNQVODDB-LJQANCHMSA-N |
| SMILES | C[C@@]1(COC(=N1)C2=CC=CC3=C2N=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)