CAS 970-26-3 is the registry number for N,N'-Diphenylbenzohydrazide, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
N,N'-diphenylbenzohydrazide (CAS 970-26-3) is a chemical compound with the molecular formula C19H16N2O and a molecular weight of 288.3 g/mol. IUPAC name: N,N'-diphenylbenzohydrazide. InChIKey: NAVYNGCXUPZVQM-UHFFFAOYSA-N.
| Molecular formula | C19H16N2O |
|---|---|
| Molecular weight | 288.3 g/mol |
| IUPAC name | N,N'-diphenylbenzohydrazide |
| InChIKey | NAVYNGCXUPZVQM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)N(C2=CC=CC=C2)NC3=CC=CC=C3 |
Computed by PubChem (NCBI)