Products 941083-73-4
CAS 941083-73-4 appears in our catalog under these names: 2-Benzyl-9-methyl-2,3-dihydro-1h-pyrrolo[3,4-b]quinolin-1-one, 95%, 2-Benzyl-9-methyl-1H,2H,3H-pyrrolo(3,4-b)quinolin-1-one, 95%, 2-Benzyl-9-methyl-1H,2H,3H-pyrrolo(3,4-b)quinolin-1-one. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
2-benzyl-9-methyl-3H-pyrrolo[3,4-b]quinolin-1-one (CAS 941083-73-4) is a chemical compound with the molecular formula C19H16N2O and a molecular weight of 288.3 g/mol. IUPAC name: 2-benzyl-9-methyl-3H-pyrrolo[3,4-b]quinolin-1-one. InChIKey: WKRTVONHHXJBQT-UHFFFAOYSA-N.
| Molecular formula | C19H16N2O |
|---|---|
| Molecular weight | 288.3 g/mol |
| IUPAC name | 2-benzyl-9-methyl-3H-pyrrolo[3,4-b]quinolin-1-one |
| InChIKey | WKRTVONHHXJBQT-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=NC3=CC=CC=C13)CN(C2=O)CC4=CC=CC=C4 |
Computed by PubChem (NCBI)