CAS 187793-06-2 is the registry number for 2-Amino-4,5-di-p-tolyl-furan-3-carbonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
2-amino-4,5-bis(4-methylphenyl)furan-3-carbonitrile (CAS 187793-06-2) is a chemical compound with the molecular formula C19H16N2O and a molecular weight of 288.3 g/mol. IUPAC name: 2-amino-4,5-bis(4-methylphenyl)furan-3-carbonitrile. InChIKey: INONLRKTDXRGKI-UHFFFAOYSA-N.
| Molecular formula | C19H16N2O |
|---|---|
| Molecular weight | 288.3 g/mol |
| IUPAC name | 2-amino-4,5-bis(4-methylphenyl)furan-3-carbonitrile |
| InChIKey | INONLRKTDXRGKI-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=C(OC(=C2C#N)N)C3=CC=C(C=C3)C |
Computed by PubChem (NCBI)