CAS 1421603-43-1 appears in our catalog under these names: 8-Chloro-5-nitro-1,2,3,4-tetrahydroquinoline, 95%, 8-Chloro-5-nitro-1,2,3,4-tetrahydroquinoline. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
8-chloro-5-nitro-1,2,3,4-tetrahydroquinoline (CAS 1421603-43-1) is a chemical compound with the molecular formula C9H9ClN2O2 and a molecular weight of 212.63 g/mol. IUPAC name: 8-chloro-5-nitro-1,2,3,4-tetrahydroquinoline. InChIKey: FRGXPNHJORJDMV-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN2O2 |
|---|---|
| Molecular weight | 212.63 g/mol |
| IUPAC name | 8-chloro-5-nitro-1,2,3,4-tetrahydroquinoline |
| InChIKey | FRGXPNHJORJDMV-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2NC1)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)