CAS 1421605-09-5 is the registry number for 5-Bromo-3-methylthiophene-2-sulfonyl chloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
5-bromo-3-methylthiophene-2-sulfonyl chloride (CAS 1421605-09-5) is a chemical compound with the molecular formula C5H4BrClO2S2 and a molecular weight of 275.6 g/mol. IUPAC name: 5-bromo-3-methylthiophene-2-sulfonyl chloride. InChIKey: MGIVCIQNHQLTNC-UHFFFAOYSA-N.
| Molecular formula | C5H4BrClO2S2 |
|---|---|
| Molecular weight | 275.6 g/mol |
| IUPAC name | 5-bromo-3-methylthiophene-2-sulfonyl chloride |
| InChIKey | MGIVCIQNHQLTNC-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=C1)Br)S(=O)(=O)Cl |
Computed by PubChem (NCBI)