Products 1421605-99-3

CAS 1421605-99-3 appears in our catalog under these names: 4-Bromo-3-methylthiophene-2-sulfonyl chloride, 4-Bromo-3-methylthiophene-2-sulfonyl chloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 1g.

4-bromo-3-methylthiophene-2-sulfonyl chloride (CAS 1421605-99-3) is a chemical compound with the molecular formula C5H4BrClO2S2 and a molecular weight of 275.6 g/mol. IUPAC name: 4-bromo-3-methylthiophene-2-sulfonyl chloride. InChIKey: XUFAFAISNKTEQS-UHFFFAOYSA-N.

Identity
Molecular formulaC5H4BrClO2S2
Molecular weight275.6 g/mol
IUPAC name4-bromo-3-methylthiophene-2-sulfonyl chloride
InChIKeyXUFAFAISNKTEQS-UHFFFAOYSA-N
SMILESCC1=C(SC=C1Br)S(=O)(=O)Cl

Computed by PubChem (NCBI)