CAS 82834-48-8 appears in our catalog under these names: 5-Bromo-2-methylthiophene-3-sulfonyl chloride, 95%, 5-Bromo-2-Methylthiophene-3-Sulfonyl Chloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 5g, 100mg.
5-bromo-2-methylthiophene-3-sulfonyl chloride (CAS 82834-48-8) is a chemical compound with the molecular formula C5H4BrClO2S2 and a molecular weight of 275.6 g/mol. IUPAC name: 5-bromo-2-methylthiophene-3-sulfonyl chloride. InChIKey: HKHREWTUTATPPJ-UHFFFAOYSA-N.
| Molecular formula | C5H4BrClO2S2 |
|---|---|
| Molecular weight | 275.6 g/mol |
| IUPAC name | 5-bromo-2-methylthiophene-3-sulfonyl chloride |
| InChIKey | HKHREWTUTATPPJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(S1)Br)S(=O)(=O)Cl |
Computed by PubChem (NCBI)