Products 82834-48-8

CAS 82834-48-8 appears in our catalog under these names: 5-Bromo-2-methylthiophene-3-sulfonyl chloride, 95%, 5-Bromo-2-Methylthiophene-3-Sulfonyl Chloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 5g, 100mg.

Structural formula: {0} (CAS {1})

5-bromo-2-methylthiophene-3-sulfonyl chloride (CAS 82834-48-8) is a chemical compound with the molecular formula C5H4BrClO2S2 and a molecular weight of 275.6 g/mol. IUPAC name: 5-bromo-2-methylthiophene-3-sulfonyl chloride. InChIKey: HKHREWTUTATPPJ-UHFFFAOYSA-N.

Identity
Molecular formulaC5H4BrClO2S2
Molecular weight275.6 g/mol
IUPAC name5-bromo-2-methylthiophene-3-sulfonyl chloride
InChIKeyHKHREWTUTATPPJ-UHFFFAOYSA-N
SMILESCC1=C(C=C(S1)Br)S(=O)(=O)Cl

Computed by PubChem (NCBI)