Products 81597-51-5

CAS 81597-51-5 appears in our catalog under these names: 5-Bromo-4-methylthiophene-2-sulfonyl chloride, 5-Bromo-4-methylthiophene-2-sulfonyl chloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.

5-bromo-4-methylthiophene-2-sulfonyl chloride (CAS 81597-51-5) is a chemical compound with the molecular formula C5H4BrClO2S2 and a molecular weight of 275.6 g/mol. IUPAC name: 5-bromo-4-methylthiophene-2-sulfonyl chloride. InChIKey: RRMFMKFGHNRQPZ-UHFFFAOYSA-N.

Identity
Molecular formulaC5H4BrClO2S2
Molecular weight275.6 g/mol
IUPAC name5-bromo-4-methylthiophene-2-sulfonyl chloride
InChIKeyRRMFMKFGHNRQPZ-UHFFFAOYSA-N
SMILESCC1=C(SC(=C1)S(=O)(=O)Cl)Br

Computed by PubChem (NCBI)