CAS 1421922-95-3 appears in our catalog under these names: 5-Acetylisoindolin-1-one, 95+%, 5-Acetylisoindolin-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
5-acetyl-2,3-dihydroisoindol-1-one (CAS 1421922-95-3) is a chemical compound with the molecular formula C10H9NO2 and a molecular weight of 175.18 g/mol. IUPAC name: 5-acetyl-2,3-dihydroisoindol-1-one. InChIKey: HZYYOSSJNNELLX-UHFFFAOYSA-N.
| Molecular formula | C10H9NO2 |
|---|---|
| Molecular weight | 175.18 g/mol |
| IUPAC name | 5-acetyl-2,3-dihydroisoindol-1-one |
| InChIKey | HZYYOSSJNNELLX-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC2=C(C=C1)C(=O)NC2 |
Computed by PubChem (NCBI)