Products 1421935-36-5
CAS 1421935-36-5 appears in our catalog under these names: (2-Hydroxy-4,6-dimethylphenyl)boronic acid, 97%, 97%, (2-Hydroxy-4,6-dimethylphenyl)boronic acid, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g.
(2-hydroxy-4,6-dimethylphenyl)boronic acid (CAS 1421935-36-5) is a chemical compound with the molecular formula C8H11BO3 and a molecular weight of 165.98 g/mol. IUPAC name: (2-hydroxy-4,6-dimethylphenyl)boronic acid. InChIKey: NZIVYRXRKCAQAE-UHFFFAOYSA-N.
| Molecular formula | C8H11BO3 |
|---|---|
| Molecular weight | 165.98 g/mol |
| IUPAC name | (2-hydroxy-4,6-dimethylphenyl)boronic acid |
| InChIKey | NZIVYRXRKCAQAE-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1O)C)C)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(2-Hydroxy-4,6-dimethylphenyl)boronic acid, 2,4-Dimethyl-6-hydroxyphenylboronic acid, 2-hydroxy-4,6-dimethylphenylboronic acid, Boronic acid, B-(2-hydroxy-4,6-dimethylphenyl)-, 4,6-Dimethyl-2-hydroxyphenylboronic acid, (2-Hydroxy-4,6-dimethylphenyl)boronicacid, (2-hydroxy-4,6-dimethyl-phenyl)boronic acid