CAS 1421944-09-3 is the registry number for 2-Methyl-6-styryl-4,5-dihydro-3(2h)-pyridazinone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-methyl-6-[(E)-2-phenylethenyl]-4,5-dihydropyridazin-3-one (CAS 1421944-09-3) is a chemical compound with the molecular formula C13H14N2O and a molecular weight of 214.26 g/mol. IUPAC name: 2-methyl-6-[(E)-2-phenylethenyl]-4,5-dihydropyridazin-3-one. InChIKey: ALNKXYSIOOSXLW-BQYQJAHWSA-N.
| Molecular formula | C13H14N2O |
|---|---|
| Molecular weight | 214.26 g/mol |
| IUPAC name | 2-methyl-6-[(E)-2-phenylethenyl]-4,5-dihydropyridazin-3-one |
| InChIKey | ALNKXYSIOOSXLW-BQYQJAHWSA-N |
| SMILES | CN1C(=O)CCC(=N1)/C=C/C2=CC=CC=C2 |
Computed by PubChem (NCBI)