CAS 1422057-40-6 is the registry number for 3-Hydroxy-5-methyl-1-phenylthieno-(2,3-d)pyrimidine-2,4(1H,3H)-dione. Offered by: Biosynth. Available pack sizes: 10mg, 25mg.
3-hydroxy-5-methyl-1-phenylthieno[2,3-d]pyrimidine-2,4-dione (CAS 1422057-40-6) is a chemical compound with the molecular formula C13H10N2O3S and a molecular weight of 274.30 g/mol. IUPAC name: 3-hydroxy-5-methyl-1-phenylthieno[2,3-d]pyrimidine-2,4-dione. InChIKey: QKYZQKJXAKNEPA-UHFFFAOYSA-N.
| Molecular formula | C13H10N2O3S |
|---|---|
| Molecular weight | 274.30 g/mol |
| IUPAC name | 3-hydroxy-5-methyl-1-phenylthieno[2,3-d]pyrimidine-2,4-dione |
| InChIKey | QKYZQKJXAKNEPA-UHFFFAOYSA-N |
| SMILES | CC1=CSC2=C1C(=O)N(C(=O)N2C3=CC=CC=C3)O |
Computed by PubChem (NCBI)