Products 1422517-82-5
CAS 1422517-82-5 appears in our catalog under these names: Nardoaristolone B, Nardoaristolone B, ≥98%. Offered by: Biosynth, MedChemExpress, Chemat. Available pack sizes: 10mg, 25mg, 50mg, 5 mg, 1 mg, 5mg.
(1aS,1bR,2R,6aR)-1,1,1b,2-tetramethyl-1a,2,3,6a-tetrahydrocyclopropa[a]indene-4,6-dione (CAS 1422517-82-5) is a chemical compound with the molecular formula C14H18O2 and a molecular weight of 218.29 g/mol. IUPAC name: (1aS,1bR,2R,6aR)-1,1,1b,2-tetramethyl-1a,2,3,6a-tetrahydrocyclopropa[a]indene-4,6-dione. InChIKey: JFKBBEXHGRBITG-KGGBIUIESA-N.
| Molecular formula | C14H18O2 |
|---|---|
| Molecular weight | 218.29 g/mol |
| IUPAC name | (1aS,1bR,2R,6aR)-1,1,1b,2-tetramethyl-1a,2,3,6a-tetrahydrocyclopropa[a]indene-4,6-dione |
| InChIKey | JFKBBEXHGRBITG-KGGBIUIESA-N |
| SMILES | C[C@@H]1CC(=O)C=C2[C@]1([C@H]3[C@@H](C2=O)C3(C)C)C |
Computed by PubChem (NCBI)
Synonyms:
Nardoaristolone B, orb1680295