Products 1422520-77-1
CAS 1422520-77-1 is the registry number for Lucidafuranocoumarin B. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[(E)-3-methyl-4-[(2S,4R)-4-methyl-5-oxooxolan-2-yl]but-2-enoxy]furo[3,2-g]chromen-7-one (CAS 1422520-77-1) is a chemical compound with the molecular formula C21H20O6 and a molecular weight of 368.4 g/mol. IUPAC name: 4-[(E)-3-methyl-4-[(2S,4R)-4-methyl-5-oxooxolan-2-yl]but-2-enoxy]furo[3,2-g]chromen-7-one. InChIKey: SVOIVAHAKDYEOL-KDHQJITESA-N.
| Molecular formula | C21H20O6 |
|---|---|
| Molecular weight | 368.4 g/mol |
| IUPAC name | 4-[(E)-3-methyl-4-[(2S,4R)-4-methyl-5-oxooxolan-2-yl]but-2-enoxy]furo[3,2-g]chromen-7-one |
| InChIKey | SVOIVAHAKDYEOL-KDHQJITESA-N |
| SMILES | C[C@@H]1C[C@H](OC1=O)C/C(=C/COC2=C3C=CC(=O)OC3=CC4=C2C=CO4)/C |
Computed by PubChem (NCBI)
Synonyms:
Lucidafuranocoumarin B