CAS 142253-55-2 appears in our catalog under these names: 1–Boc–azetidine–3–carboxylic acid, Boc-3Aze-OH, 1-Boc-azetidine-3-carboxylic acid, 97% , 1-(tert-Butoxycarbonyl)azetidine-3-carboxylic Acid, >98.0%(GC)(T), 1-N-Boc-3-Azetidinecarboxylic acid 97%. Offered by: GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar), TCI, Ambeed. Available pack sizes: 1g, 500mg, 5g, 25g, 10g, 100g, 500g, 5kg.
1-[(2-methylpropan-2-yl)oxycarbonyl]azetidine-3-carboxylic acid (CAS 142253-55-2) is a chemical compound with the molecular formula C9H15NO4 and a molecular weight of 201.22 g/mol. IUPAC name: 1-[(2-methylpropan-2-yl)oxycarbonyl]azetidine-3-carboxylic acid. InChIKey: NCADHSLPNSTDMJ-UHFFFAOYSA-N.
| Molecular formula | C9H15NO4 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | 1-[(2-methylpropan-2-yl)oxycarbonyl]azetidine-3-carboxylic acid |
| InChIKey | NCADHSLPNSTDMJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)C(=O)O |
Computed by PubChem (NCBI)