Products 1422971-97-8
CAS 1422971-97-8 is the registry number for Benzoic acid, 4-bromo-2-cyclopropyl-, methyl ester, >95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg.
Methyl 4-bromo-2-cyclopropylbenzoate (CAS 1422971-97-8) is a chemical compound with the molecular formula C11H11BrO2 and a molecular weight of 255.11 g/mol. IUPAC name: methyl 4-bromo-2-cyclopropylbenzoate. InChIKey: DHHWCQWQQTYIJE-UHFFFAOYSA-N.
| Molecular formula | C11H11BrO2 |
|---|---|
| Molecular weight | 255.11 g/mol |
| IUPAC name | methyl 4-bromo-2-cyclopropylbenzoate |
| InChIKey | DHHWCQWQQTYIJE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)Br)C2CC2 |
Computed by PubChem (NCBI)