Products 1423025-63-1

CAS 1423025-63-1 is the registry number for 2-Amino-2-methylcyclohexane-1-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.

Structural formula: {0} (CAS {1})

2-amino-2-methylcyclohexane-1-carboxylic acid;hydrochloride (CAS 1423025-63-1) is a chemical compound with the molecular formula C8H16ClNO2 and a molecular weight of 193.67 g/mol. IUPAC name: 2-amino-2-methylcyclohexane-1-carboxylic acid;hydrochloride. InChIKey: RIKSICCAWWEQSL-UHFFFAOYSA-N.

Identity
Molecular formulaC8H16ClNO2
Molecular weight193.67 g/mol
IUPAC name2-amino-2-methylcyclohexane-1-carboxylic acid;hydrochloride
InChIKeyRIKSICCAWWEQSL-UHFFFAOYSA-N
SMILESCC1(CCCCC1C(=O)O)N.Cl

Computed by PubChem (NCBI)