CAS 202921-88-8 appears in our catalog under these names: Cis-2-amino-2-methyl-cyclohexanecarboxylic acid hydrochloride, 95%, Cis-2-amino-2-methylcyclohexanecarboxylic acid hydrochloride, 97%, cis-2-Amino-2-Me-cyclohexane-COOH*HCl. Offered by: Combi-blocks, AmBeed, Iris Biotech. Available pack sizes: 5g, 250mg, 1g, 100mg.
Cis-(1S,2R)-2-amino-2-methylcyclohexane-1-carboxylic acid;hydrochloride (CAS 202921-88-8) is a chemical compound with the molecular formula C8H16ClNO2 and a molecular weight of 193.67 g/mol. IUPAC name: cis-(1S,2R)-2-amino-2-methylcyclohexane-1-carboxylic acid;hydrochloride. InChIKey: RIKSICCAWWEQSL-CIRBGYJCSA-N.
| Molecular formula | C8H16ClNO2 |
|---|---|
| Molecular weight | 193.67 g/mol |
| IUPAC name | cis-(1S,2R)-2-amino-2-methylcyclohexane-1-carboxylic acid;hydrochloride |
| InChIKey | RIKSICCAWWEQSL-CIRBGYJCSA-N |
| SMILES | C[C@]1(CCCC[C@@H]1C(=O)O)N.Cl |
Computed by PubChem (NCBI)