Products 1423029-19-9
CAS 1423029-19-9 appears in our catalog under these names: 4-(5-Chloro-3-methyl-1H-pyrazol-1-yl)benzonitrile, 95%, 4-(5-Chloro-3-methyl-1H-pyrazol-1-yl)benzonitrile. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
4-(5-chloro-3-methylpyrazol-1-yl)benzonitrile (CAS 1423029-19-9) is a chemical compound with the molecular formula C11H8ClN3 and a molecular weight of 217.65 g/mol. IUPAC name: 4-(5-chloro-3-methylpyrazol-1-yl)benzonitrile. InChIKey: TWJYQPGOHHDPKU-UHFFFAOYSA-N.
| Molecular formula | C11H8ClN3 |
|---|---|
| Molecular weight | 217.65 g/mol |
| IUPAC name | 4-(5-chloro-3-methylpyrazol-1-yl)benzonitrile |
| InChIKey | TWJYQPGOHHDPKU-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1)Cl)C2=CC=C(C=C2)C#N |
Computed by PubChem (NCBI)