Products 1423029-25-7
CAS 1423029-25-7 is the registry number for 2-(3-Oxocycloheptyl)-2,3-dihydro-1H-isoindole-1,3-dione. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(3-oxocycloheptyl)isoindole-1,3-dione (CAS 1423029-25-7) is a chemical compound with the molecular formula C15H15NO3 and a molecular weight of 257.28 g/mol. IUPAC name: 2-(3-oxocycloheptyl)isoindole-1,3-dione. InChIKey: YPBLZWKNRAQYQM-UHFFFAOYSA-N.
| Molecular formula | C15H15NO3 |
|---|---|
| Molecular weight | 257.28 g/mol |
| IUPAC name | 2-(3-oxocycloheptyl)isoindole-1,3-dione |
| InChIKey | YPBLZWKNRAQYQM-UHFFFAOYSA-N |
| SMILES | C1CCC(=O)CC(C1)N2C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)