Products 1423029-30-4
CAS 1423029-30-4 is the registry number for Ethyl 5-amino-2-(thiophen-2-yl)-1,3-oxazole-4-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Ethyl 5-amino-2-thiophen-2-yl-1,3-oxazole-4-carboxylate (CAS 1423029-30-4) is a chemical compound with the molecular formula C10H10N2O3S and a molecular weight of 238.27 g/mol. IUPAC name: ethyl 5-amino-2-thiophen-2-yl-1,3-oxazole-4-carboxylate. InChIKey: REJVAPPTRPVTHU-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O3S |
|---|---|
| Molecular weight | 238.27 g/mol |
| IUPAC name | ethyl 5-amino-2-thiophen-2-yl-1,3-oxazole-4-carboxylate |
| InChIKey | REJVAPPTRPVTHU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(OC(=N1)C2=CC=CS2)N |
Computed by PubChem (NCBI)