Products 1423032-05-6
CAS 1423032-05-6 is the registry number for 2-(2,2-Difluoroethoxy)pyridine-3-carbonitrile. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(2,2-difluoroethoxy)pyridine-3-carbonitrile (CAS 1423032-05-6) is a chemical compound with the molecular formula C8H6F2N2O and a molecular weight of 184.14 g/mol. IUPAC name: 2-(2,2-difluoroethoxy)pyridine-3-carbonitrile. InChIKey: UOLLSNJVROMVMN-UHFFFAOYSA-N.
| Molecular formula | C8H6F2N2O |
|---|---|
| Molecular weight | 184.14 g/mol |
| IUPAC name | 2-(2,2-difluoroethoxy)pyridine-3-carbonitrile |
| InChIKey | UOLLSNJVROMVMN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)OCC(F)F)C#N |
Computed by PubChem (NCBI)