CAS 1423032-18-1 appears in our catalog under these names: 2-Amino-2-[4-(trifluoromethyl)phenyl]ethan-1-ol hydrochloride, 95%, 2-Amino-2-(4-(trifluoromethyl)phenyl)ethanol hydrochloride, 97%, 2-Amino-2-(4-(trifluoromethyl)phenyl)ethanol hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 5g, 100mg, 1g.
2-amino-2-[4-(trifluoromethyl)phenyl]ethanol;hydrochloride (CAS 1423032-18-1) is a chemical compound with the molecular formula C9H11ClF3NO and a molecular weight of 241.64 g/mol. IUPAC name: 2-amino-2-[4-(trifluoromethyl)phenyl]ethanol;hydrochloride. InChIKey: LKRCVAWTGZSLFR-UHFFFAOYSA-N.
| Molecular formula | C9H11ClF3NO |
|---|---|
| Molecular weight | 241.64 g/mol |
| IUPAC name | 2-amino-2-[4-(trifluoromethyl)phenyl]ethanol;hydrochloride |
| InChIKey | LKRCVAWTGZSLFR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(CO)N)C(F)(F)F.Cl |
Computed by PubChem (NCBI)