CAS 1423032-53-4 is the registry number for 7,8-Dichloro-1,2,3,4-tetrahydroquinolin-2-one. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
7,8-dichloro-3,4-dihydro-1H-quinolin-2-one (CAS 1423032-53-4) is a chemical compound with the molecular formula C9H7Cl2NO and a molecular weight of 216.06 g/mol. IUPAC name: 7,8-dichloro-3,4-dihydro-1H-quinolin-2-one. InChIKey: SVKCLUNCNNDCLZ-UHFFFAOYSA-N.
| Molecular formula | C9H7Cl2NO |
|---|---|
| Molecular weight | 216.06 g/mol |
| IUPAC name | 7,8-dichloro-3,4-dihydro-1H-quinolin-2-one |
| InChIKey | SVKCLUNCNNDCLZ-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC2=C1C=CC(=C2Cl)Cl |
Computed by PubChem (NCBI)