Products 1423034-11-0
CAS 1423034-11-0 appears in our catalog under these names: 4-Chloropyrido(2,3-d)pyrimidin-7-amine, 97%, 4-Chloropyrido(2,3-d)pyrimidin-7-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 50mg, 0,5g.
4-chloropyrido[2,3-d]pyrimidin-7-amine (CAS 1423034-11-0) is a chemical compound with the molecular formula C7H5ClN4 and a molecular weight of 180.59 g/mol. IUPAC name: 4-chloropyrido[2,3-d]pyrimidin-7-amine. InChIKey: UWJFEIGJUKIOPS-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN4 |
|---|---|
| Molecular weight | 180.59 g/mol |
| IUPAC name | 4-chloropyrido[2,3-d]pyrimidin-7-amine |
| InChIKey | UWJFEIGJUKIOPS-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C1C(=NC=N2)Cl)N |
Computed by PubChem (NCBI)