CAS 142330-94-7 is the registry number for 7-Chloro-6-methyl-4H-(1,2,3)triazolo(4,3-c)(1,4)oxazin-4-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
7-chloro-6-methyltriazolo[5,1-c][1,4]oxazin-4-one (CAS 142330-94-7) is a chemical compound with the molecular formula C6H4ClN3O2 and a molecular weight of 185.57 g/mol. IUPAC name: 7-chloro-6-methyltriazolo[5,1-c][1,4]oxazin-4-one. InChIKey: RNRDGOKPGMEYDT-UHFFFAOYSA-N.
| Molecular formula | C6H4ClN3O2 |
|---|---|
| Molecular weight | 185.57 g/mol |
| IUPAC name | 7-chloro-6-methyltriazolo[5,1-c][1,4]oxazin-4-one |
| InChIKey | RNRDGOKPGMEYDT-UHFFFAOYSA-N |
| SMILES | CC1=C(N2C(=CN=N2)C(=O)O1)Cl |
Computed by PubChem (NCBI)