CAS 2029189-45-3 is the registry number for 7-Chloro-1,4-dihydro-2H-pyrimido[4,5-d][1,3]oxazin-2-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
7-chloro-1,4-dihydropyrimido[4,5-d][1,3]oxazin-2-one (CAS 2029189-45-3) is a chemical compound with the molecular formula C6H4ClN3O2 and a molecular weight of 185.57 g/mol. IUPAC name: 7-chloro-1,4-dihydropyrimido[4,5-d][1,3]oxazin-2-one. InChIKey: ZNCRJTIMFHPTOH-UHFFFAOYSA-N.
| Molecular formula | C6H4ClN3O2 |
|---|---|
| Molecular weight | 185.57 g/mol |
| IUPAC name | 7-chloro-1,4-dihydropyrimido[4,5-d][1,3]oxazin-2-one |
| InChIKey | ZNCRJTIMFHPTOH-UHFFFAOYSA-N |
| SMILES | C1C2=CN=C(N=C2NC(=O)O1)Cl |
Computed by PubChem (NCBI)